ChemNet > CAS > 1455-18-1 3-Methylbenzo[b]thiophene
1455-18-1 3-Methylbenzo[b]thiophene
상품명칭 |
3-Methylbenzo[b]thiophene |
영문 이름 |
3-Methylbenzo[b]thiophene; Methylbenzobthiophene; 3-Methylthianaphthene; 3-methyl-1-benzothiophene |
분자식 |
C9H8S |
분자량 |
148.2248 |
InChI |
InChI=1/C9H8S/c1-7-6-10-9-5-3-2-4-8(7)9/h2-6H,1H3 |
cas번호 |
1455-18-1 |
EC번호 |
215-934-6 |
분자 구조 |
|
밀도 |
1.146g/cm3 |
비등점 |
243°C at 760 mmHg |
굴절 지수 |
1.652 |
인화점 |
72.4°C |
증기압 |
0.0514mmHg at 25°C |
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|